Products 135821-94-2
CAS 135821-94-2 is the registry number for Methyl (2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanoate (CAS 135821-94-2) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: methyl (2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanoate. InChIKey: UYJLJICUXJPKTB-CABCVRRESA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | methyl (2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanoate |
| InChIKey | UYJLJICUXJPKTB-CABCVRRESA-N |
| SMILES | COC(=O)[C@H]([C@@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)