CAS 13209-33-1 is the registry number for 4,5-Dichlorophthalaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichlorophthalaldehyde (CAS 13209-33-1) is a chemical compound with the molecular formula C8H4Cl2O2 and a molecular weight of 203.02 g/mol. IUPAC name: 4,5-dichlorophthalaldehyde. InChIKey: UUAVOMUOLIKJHY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O2 |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 4,5-dichlorophthalaldehyde |
| InChIKey | UUAVOMUOLIKJHY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)C=O)C=O |
Computed by PubChem (NCBI)