Products 74815-20-6
CAS 74815-20-6 appears in our catalog under these names: 5,7-Dichloro-benzofuran-3-one, 95%, 5,7-Dichlorobenzo(b)furan-3(2H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
5,7-dichloro-1-benzofuran-3-one (CAS 74815-20-6) is a chemical compound with the molecular formula C8H4Cl2O2 and a molecular weight of 203.02 g/mol. IUPAC name: 5,7-dichloro-1-benzofuran-3-one. InChIKey: UUSSNGDCNFQCII-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O2 |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 5,7-dichloro-1-benzofuran-3-one |
| InChIKey | UUSSNGDCNFQCII-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(O1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)