Products 100-20-9
CAS 100-20-9 appears in our catalog under these names: Terephthaloyl Chloride, Terephthaloyl chloride, 99% , Terephthaloyl Chloride, >99.0%(GC)(T), Terephthaloyl chloride, 99+%, Terephthaloyl chloride, 99.00%. Offered by: TRC, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Thermo Scientific (Acros). Available pack sizes: 10g, 2,5g, 50g, 1000g, 250g, 25g, 100g, 500g.
Benzene-1,4-dicarbonyl chloride (CAS 100-20-9) is a chemical compound with the molecular formula C8H4Cl2O2 and a molecular weight of 203.02 g/mol. IUPAC name: benzene-1,4-dicarbonyl chloride. InChIKey: LXEJRKJRKIFVNY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O2 |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | benzene-1,4-dicarbonyl chloride |
| InChIKey | LXEJRKJRKIFVNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)C(=O)Cl |
Computed by PubChem (NCBI)