CAS 153147-35-4 is the registry number for 2-(2,4-Dichlorophenyl)-2-oxoacetaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dichlorophenyl)-2-oxoacetaldehyde (CAS 153147-35-4) is a chemical compound with the molecular formula C8H4Cl2O2 and a molecular weight of 203.02 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2-oxoacetaldehyde. InChIKey: XQZIEIIQHUCWSQ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O2 |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2-oxoacetaldehyde |
| InChIKey | XQZIEIIQHUCWSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)C=O |
Computed by PubChem (NCBI)