Products 1323966-44-4
CAS 1323966-44-4 appears in our catalog under these names: 4'-Chloro-2'-fluoro-3'-methoxyacetophenone, 95%, 1-(4-Chloro-2-fluoro-3-methoxyphenyl)ethanone 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
1-(4-chloro-2-fluoro-3-methoxyphenyl)ethanone (CAS 1323966-44-4) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 1-(4-chloro-2-fluoro-3-methoxyphenyl)ethanone. InChIKey: SSQUECJMKSQDHG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 1-(4-chloro-2-fluoro-3-methoxyphenyl)ethanone |
| InChIKey | SSQUECJMKSQDHG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)Cl)OC)F |
Computed by PubChem (NCBI)