CAS 132529-83-0 is the registry number for 4-(3-Bromo-4-methylphenoxy)benzonitrile, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-(3-bromo-4-methylphenoxy)benzonitrile (CAS 132529-83-0) is a chemical compound with the molecular formula C14H10BrNO and a molecular weight of 288.14 g/mol. IUPAC name: 4-(3-bromo-4-methylphenoxy)benzonitrile. InChIKey: WFIQAXOUNRXCMT-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 4-(3-bromo-4-methylphenoxy)benzonitrile |
| InChIKey | WFIQAXOUNRXCMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=CC=C(C=C2)C#N)Br |
Computed by PubChem (NCBI)