CAS 143540-56-1 appears in our catalog under these names: Desloratadine Impurity 19, Desloratadine 8-Bromo-11-Oxo Impurity, 8-Bromo-5,6-dihydro-11H-benzo(5,6)cyclohepta(1,2-b)pyridin-11-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 50mg.
13-bromo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (CAS 143540-56-1) is a chemical compound with the molecular formula C14H10BrNO and a molecular weight of 288.14 g/mol. IUPAC name: 13-bromo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one. InChIKey: ABQDSBOUVLUFNK-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 13-bromo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| InChIKey | ABQDSBOUVLUFNK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)C(=O)C3=C1C=CC=N3 |
Computed by PubChem (NCBI)