CAS 915921-41-4 is the registry number for 2-Benzyl-5-bromo-1,3-benzoxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-benzyl-5-bromo-1,3-benzoxazole (CAS 915921-41-4) is a chemical compound with the molecular formula C14H10BrNO and a molecular weight of 288.14 g/mol. IUPAC name: 2-benzyl-5-bromo-1,3-benzoxazole. InChIKey: GIXLJAZFGSWIOI-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 2-benzyl-5-bromo-1,3-benzoxazole |
| InChIKey | GIXLJAZFGSWIOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)