CAS 2089301-66-4 is the registry number for 7-Bromo-2-phenylisoindolin-1-one 95%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
7-bromo-2-phenyl-3H-isoindol-1-one (CAS 2089301-66-4) is a chemical compound with the molecular formula C14H10BrNO and a molecular weight of 288.14 g/mol. IUPAC name: 7-bromo-2-phenyl-3H-isoindol-1-one. InChIKey: WPXXOBMFWFQJHG-UHFFFAOYSA-N.
| Molecular formula | C14H10BrNO |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 7-bromo-2-phenyl-3H-isoindol-1-one |
| InChIKey | WPXXOBMFWFQJHG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)Br)C(=O)N1C3=CC=CC=C3 |
Computed by PubChem (NCBI)