Products 1325559-19-0
CAS 1325559-19-0 appears in our catalog under these names: Mefenamic acid-13C6, 13C6-Mefenamic acid, 13C6-Mefenamic acid, 100 µg/ml in Acetonitrile, ISO 17034 CRM, Mefenamic acid-(benzoic ring-<H/13>C<I/6. Offered by: MedChemExpress, HPC Standards, Sigma-Aldrich. Available pack sizes: 5mg, 1mg, 10mg, 1ml.
6-(2,3-dimethylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 1325559-19-0) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 247.24 g/mol. IUPAC name: 6-(2,3-dimethylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: HYYBABOKPJLUIN-MQISJZSBSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | 6-(2,3-dimethylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | HYYBABOKPJLUIN-MQISJZSBSA-N |
| SMILES | CC1=C(C(=CC=C1)N[13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2C(=O)O)C |
Computed by PubChem (NCBI)