Products 1325614-47-8
CAS 1325614-47-8 is the registry number for 2-(4-Bromo-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
2-(4-bromo-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1325614-47-8) is a chemical compound with the molecular formula C12H15BBrClO2 and a molecular weight of 317.41 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SCYASPDQXRAWQT-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrClO2 |
|---|---|
| Molecular weight | 317.41 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SCYASPDQXRAWQT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)