CAS 1325681-85-3 is the registry number for 1-(4-Methylbenzoyl)-N-phenyl-1H-indazole-3-carboxamide. Offered by: Biosynth. Available pack sizes: 5000mg.
1-(4-methylbenzoyl)-N-phenylindazole-3-carboxamide (CAS 1325681-85-3) is a chemical compound with the molecular formula C22H17N3O2 and a molecular weight of 355.4 g/mol. IUPAC name: 1-(4-methylbenzoyl)-N-phenylindazole-3-carboxamide. InChIKey: FBVXURGANMWXMI-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 1-(4-methylbenzoyl)-N-phenylindazole-3-carboxamide |
| InChIKey | FBVXURGANMWXMI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)N2C3=CC=CC=C3C(=N2)C(=O)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)