Products 47531-44-2
CAS 47531-44-2 is the registry number for 9,10-Anthracenedione, 1-[[4-(dimethylamino)phenyl]azo]-. Offered by: Chemat. Available pack sizes: 50mg.
1-[[4-(dimethylamino)phenyl]diazenyl]anthracene-9,10-dione (CAS 47531-44-2) is a chemical compound with the molecular formula C22H17N3O2 and a molecular weight of 355.4 g/mol. IUPAC name: 1-[[4-(dimethylamino)phenyl]diazenyl]anthracene-9,10-dione. InChIKey: BRZXLFVLBKLMQB-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 1-[[4-(dimethylamino)phenyl]diazenyl]anthracene-9,10-dione |
| InChIKey | BRZXLFVLBKLMQB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=CC3=C2C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)