CAS 2766689-18-1 is the registry number for 2-Methylbiphenyl-oxadiazole-NH-Ph-CHO. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[5-(2-methyl-3-phenylphenyl)-1,3,4-oxadiazol-2-yl]amino]benzaldehyde (CAS 2766689-18-1) is a chemical compound with the molecular formula C22H17N3O2 and a molecular weight of 355.4 g/mol. IUPAC name: 3-[[5-(2-methyl-3-phenylphenyl)-1,3,4-oxadiazol-2-yl]amino]benzaldehyde. InChIKey: KVFZHPFIDLAXDH-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 3-[[5-(2-methyl-3-phenylphenyl)-1,3,4-oxadiazol-2-yl]amino]benzaldehyde |
| InChIKey | KVFZHPFIDLAXDH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C2=NN=C(O2)NC3=CC=CC(=C3)C=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)