Products 2611225-94-4
CAS 2611225-94-4 is the registry number for N1-(Anthracen-9-yl)-N2-(pyridin-2-ylmethyl)oxalamide, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
N'-anthracen-9-yl-N-(pyridin-2-ylmethyl)oxamide (CAS 2611225-94-4) is a chemical compound with the molecular formula C22H17N3O2 and a molecular weight of 355.4 g/mol. IUPAC name: N'-anthracen-9-yl-N-(pyridin-2-ylmethyl)oxamide. InChIKey: ILYOPOVFWZETII-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | N'-anthracen-9-yl-N-(pyridin-2-ylmethyl)oxamide |
| InChIKey | ILYOPOVFWZETII-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2NC(=O)C(=O)NCC4=CC=CC=N4 |
Computed by PubChem (NCBI)