Products 132600-13-6
CAS 132600-13-6 appears in our catalog under these names: 2-((3-Oxocyclohex-1-enyl)amino)benzoic acid, 2-((3-Oxocyclohex-1-enyl)amino)benzoic acid, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 2g, 5g, 10g.
2-[(3-oxocyclohexen-1-yl)amino]benzoic acid (CAS 132600-13-6) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: 2-[(3-oxocyclohexen-1-yl)amino]benzoic acid. InChIKey: YFMAYMKMNUQNBC-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-[(3-oxocyclohexen-1-yl)amino]benzoic acid |
| InChIKey | YFMAYMKMNUQNBC-UHFFFAOYSA-N |
| SMILES | C1CC(=CC(=O)C1)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)