Products 132603-41-9
CAS 132603-41-9 is the registry number for 4-(benzo(3,4-d)1,3-dioxolen-5-ylmethylene)-3-methyl-1-phenyl-2-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
(4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-5-methyl-2-phenylpyrazol-3-one (CAS 132603-41-9) is a chemical compound with the molecular formula C18H14N2O3 and a molecular weight of 306.3 g/mol. IUPAC name: (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-5-methyl-2-phenylpyrazol-3-one. InChIKey: RPCALRBJAYDENZ-DHDCSXOGSA-N.
| Molecular formula | C18H14N2O3 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-5-methyl-2-phenylpyrazol-3-one |
| InChIKey | RPCALRBJAYDENZ-DHDCSXOGSA-N |
| SMILES | CC\1=NN(C(=O)/C1=C\C2=CC3=C(C=C2)OCO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)