CAS 132603-50-0 is the registry number for 3-methyl-1-phenyl-4-(2-thienylmethylene)-2-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
(4E)-5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one (CAS 132603-50-0) is a chemical compound with the molecular formula C15H12N2OS and a molecular weight of 268.3 g/mol. IUPAC name: (4E)-5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one. InChIKey: VUYSZSSFJKWRMX-GXDHUFHOSA-N.
| Molecular formula | C15H12N2OS |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | (4E)-5-methyl-2-phenyl-4-(thiophen-2-ylmethylidene)pyrazol-3-one |
| InChIKey | VUYSZSSFJKWRMX-GXDHUFHOSA-N |
| SMILES | CC\1=NN(C(=O)/C1=C/C2=CC=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)