Products 132629-37-9

CAS 132629-37-9 is the registry number for Ethyl 2-((1E)-2-phenylethenyl)-1,3-oxazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxylate (CAS 132629-37-9) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: ethyl 2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxylate. InChIKey: LKUGERMRWPZXRN-CMDGGOBGSA-N.

Identity
Molecular formulaC14H13NO3
Molecular weight243.26 g/mol
IUPAC nameethyl 2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxylate
InChIKeyLKUGERMRWPZXRN-CMDGGOBGSA-N
SMILESCCOC(=O)C1=COC(=N1)/C=C/C2=CC=CC=C2

Computed by PubChem (NCBI)