CAS 132629-37-9 is the registry number for Ethyl 2-((1E)-2-phenylethenyl)-1,3-oxazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxylate (CAS 132629-37-9) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: ethyl 2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxylate. InChIKey: LKUGERMRWPZXRN-CMDGGOBGSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | ethyl 2-[(E)-2-phenylethenyl]-1,3-oxazole-4-carboxylate |
| InChIKey | LKUGERMRWPZXRN-CMDGGOBGSA-N |
| SMILES | CCOC(=O)C1=COC(=N1)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)