CAS 1326614-35-0 is the registry number for 5-Bromo-n,2-dimethoxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-N,2-dimethoxybenzamide (CAS 1326614-35-0) is a chemical compound with the molecular formula C9H10BrNO3 and a molecular weight of 260.08 g/mol. IUPAC name: 5-bromo-N,2-dimethoxybenzamide. InChIKey: DJTNPXOXKVPMBB-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO3 |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | 5-bromo-N,2-dimethoxybenzamide |
| InChIKey | DJTNPXOXKVPMBB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)C(=O)NOC |
Computed by PubChem (NCBI)