CAS 132669-28-4 is the registry number for 3-Chloro-n-(3,4-difluorophenyl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-chloro-N-(3,4-difluorophenyl)propanamide (CAS 132669-28-4) is a chemical compound with the molecular formula C9H8ClF2NO and a molecular weight of 219.61 g/mol. IUPAC name: 3-chloro-N-(3,4-difluorophenyl)propanamide. InChIKey: VBUIQHWEHAHIKQ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO |
|---|---|
| Molecular weight | 219.61 g/mol |
| IUPAC name | 3-chloro-N-(3,4-difluorophenyl)propanamide |
| InChIKey | VBUIQHWEHAHIKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CCCl)F)F |
Computed by PubChem (NCBI)