Products 326006-54-6
CAS 326006-54-6 is the registry number for N-(2-Chloro-4-methylphenyl)-2,2-difluoroacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-chloro-4-methylphenyl)-2,2-difluoroacetamide (CAS 326006-54-6) is a chemical compound with the molecular formula C9H8ClF2NO and a molecular weight of 219.61 g/mol. IUPAC name: N-(2-chloro-4-methylphenyl)-2,2-difluoroacetamide. InChIKey: LOXVCYDZADOSIF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO |
|---|---|
| Molecular weight | 219.61 g/mol |
| IUPAC name | N-(2-chloro-4-methylphenyl)-2,2-difluoroacetamide |
| InChIKey | LOXVCYDZADOSIF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C(F)F)Cl |
Computed by PubChem (NCBI)