CAS 923691-22-9 appears in our catalog under these names: 2-Chloro-n-(2,6-difluorophenyl)propanamide, 95%, N-(2,6-Difluorophenyl)-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 5000mg.
2-chloro-N-(2,6-difluorophenyl)propanamide (CAS 923691-22-9) is a chemical compound with the molecular formula C9H8ClF2NO and a molecular weight of 219.61 g/mol. IUPAC name: 2-chloro-N-(2,6-difluorophenyl)propanamide. InChIKey: IACRTSGQFIYLQN-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO |
|---|---|
| Molecular weight | 219.61 g/mol |
| IUPAC name | 2-chloro-N-(2,6-difluorophenyl)propanamide |
| InChIKey | IACRTSGQFIYLQN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C=CC=C1F)F)Cl |
Computed by PubChem (NCBI)