Products 2353273-92-2
CAS 2353273-92-2 is the registry number for 3-(2-Chloro-4,5-difluorophenoxy)azetidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-chloro-4,5-difluorophenoxy)azetidine (CAS 2353273-92-2) is a chemical compound with the molecular formula C9H8ClF2NO and a molecular weight of 219.61 g/mol. IUPAC name: 3-(2-chloro-4,5-difluorophenoxy)azetidine. InChIKey: YRTMAIJUQBTXBC-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO |
|---|---|
| Molecular weight | 219.61 g/mol |
| IUPAC name | 3-(2-chloro-4,5-difluorophenoxy)azetidine |
| InChIKey | YRTMAIJUQBTXBC-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC(=C(C=C2Cl)F)F |
Computed by PubChem (NCBI)