CAS 132684-62-9 is the registry number for NPC-15669. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[(2,7-dimethyl-9H-fluoren-9-yl)methoxycarbonylamino]-4-methylpentanoic acid (CAS 132684-62-9) is a chemical compound with the molecular formula C23H27NO4 and a molecular weight of 381.5 g/mol. IUPAC name: (2S)-2-[(2,7-dimethyl-9H-fluoren-9-yl)methoxycarbonylamino]-4-methylpentanoic acid. InChIKey: SEHPSBSPFWAVPK-NRFANRHFSA-N.
| Molecular formula | C23H27NO4 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | (2S)-2-[(2,7-dimethyl-9H-fluoren-9-yl)methoxycarbonylamino]-4-methylpentanoic acid |
| InChIKey | SEHPSBSPFWAVPK-NRFANRHFSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=C(C2COC(=O)N[C@@H](CC(C)C)C(=O)O)C=C(C=C3)C |
Computed by PubChem (NCBI)