CAS 132690-91-6 appears in our catalog under these names: 4-(2-Boc-aminoethyl)benzoicacid, 4-(2-((Tert-Butoxycarbonyl)Amino)Ethyl)Benzoic Acid, 95%, 95%, 4-(2-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 99.91%, 4-(2-tert-Butoxycarbonylaminoethyl)benzoic acid, 95%. Offered by: Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 25g, 100g, 10 g.
4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid (CAS 132690-91-6) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid. InChIKey: IIHASBWHDACFGZ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid |
| InChIKey | IIHASBWHDACFGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)