Products 132829-83-5
CAS 132829-83-5 is the registry number for Espatropate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2R)-3-hydroxy-2-imidazol-1-yl-2-phenylpropanoate (CAS 132829-83-5) is a chemical compound with the molecular formula C19H23N3O3 and a molecular weight of 341.4 g/mol. IUPAC name: [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2R)-3-hydroxy-2-imidazol-1-yl-2-phenylpropanoate. InChIKey: MDJOZYCYNUJABP-HKUYNNGSSA-N.
| Molecular formula | C19H23N3O3 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2R)-3-hydroxy-2-imidazol-1-yl-2-phenylpropanoate |
| InChIKey | MDJOZYCYNUJABP-HKUYNNGSSA-N |
| SMILES | C1CN2CCC1[C@H](C2)OC(=O)[C@](CO)(C3=CC=CC=C3)N4C=CN=C4 |
Computed by PubChem (NCBI)