CAS 132871-09-1 is the registry number for (R)-1-Benzyl-3-methylpiperazine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
(3R)-1-benzyl-3-methylpiperazine-2,5-dione (CAS 132871-09-1) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: (3R)-1-benzyl-3-methylpiperazine-2,5-dione. InChIKey: HNTYWRJULQTORS-SECBINFHSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (3R)-1-benzyl-3-methylpiperazine-2,5-dione |
| InChIKey | HNTYWRJULQTORS-SECBINFHSA-N |
| SMILES | C[C@@H]1C(=O)N(CC(=O)N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)