Products 1328893-14-6

CAS 1328893-14-6 appears in our catalog under these names: 2,6-Dichloro-4-methyl-11H-pyrido(2,1-b)quinazolin-11-one, Chlorantraniliprole Metabolite IN-ECD73, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Biosynth, HPC Standards. Available pack sizes: 100mg, 0,5g, 50mg, 1x1ml.

Structural formula: {0} (CAS {1})

2,6-dichloro-4-methylpyrido[2,1-b]quinazolin-11-one (CAS 1328893-14-6) is a chemical compound with the molecular formula C13H8Cl2N2O and a molecular weight of 279.12 g/mol. IUPAC name: 2,6-dichloro-4-methylpyrido[2,1-b]quinazolin-11-one. InChIKey: HWZYDXZSGZCNEA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8Cl2N2O
Molecular weight279.12 g/mol
IUPAC name2,6-dichloro-4-methylpyrido[2,1-b]quinazolin-11-one
InChIKeyHWZYDXZSGZCNEA-UHFFFAOYSA-N
SMILESCC1=CC(=CC2=C1N=C3C(=CC=CN3C2=O)Cl)Cl

Computed by PubChem (NCBI)