CAS 293737-85-6 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)-1,3-benzoxazol-5-amine, 95%, 2-(3,4-Dichlorophenyl)benzo(d)oxazol-5-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-amine (CAS 293737-85-6) is a chemical compound with the molecular formula C13H8Cl2N2O and a molecular weight of 279.12 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-amine. InChIKey: HQSOXCXPMQPFKP-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2O |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | HQSOXCXPMQPFKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC3=C(O2)C=CC(=C3)N)Cl)Cl |
Computed by PubChem (NCBI)