CAS 6626-40-0 appears in our catalog under these names: 7,10-Dichloro-2-methoxybenzo(b)(1,5)naphthyridine, >95% (HPLC), 7,10-Dichloro-2-methoxybenzo[b]-1,5-naphthyridine 95%, 7,10-Dichloro-2-methoxybenzo[b]-1,5-naphthyridine, 95%. Offered by: TRC, Ambeed, Fluorochem. Available pack sizes: 500mg, 5g, 250mg, 1g, 25g, 100g.
7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine (CAS 6626-40-0) is a chemical compound with the molecular formula C13H8Cl2N2O and a molecular weight of 279.12 g/mol. IUPAC name: 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine. InChIKey: KHPZCNJKNIHKPI-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2O |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 7,10-dichloro-2-methoxybenzo[b][1,5]naphthyridine |
| InChIKey | KHPZCNJKNIHKPI-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C3=C(C=C(C=C3)Cl)N=C2C=C1)Cl |
Computed by PubChem (NCBI)