Products 1337881-43-2
CAS 1337881-43-2 is the registry number for 2-(2,6-Dichlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dichlorophenyl)-3H-pyrrolo[3,4-c]pyridin-1-one (CAS 1337881-43-2) is a chemical compound with the molecular formula C13H8Cl2N2O and a molecular weight of 279.12 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-3H-pyrrolo[3,4-c]pyridin-1-one. InChIKey: WGOHOYXWOVJABS-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2O |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-3H-pyrrolo[3,4-c]pyridin-1-one |
| InChIKey | WGOHOYXWOVJABS-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CN=C2)C(=O)N1C3=C(C=CC=C3Cl)Cl |
Computed by PubChem (NCBI)