CAS 1328939-64-5 appears in our catalog under these names: 1-{4-((2,2,2-trifluoroethyl)sulfanyl)phenyl}ethan-1-one, 95%, 1-{4-((2,2,2-Trifluoroethyl)sulfanyl)phenyl}ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[4-(2,2,2-trifluoroethylsulfanyl)phenyl]ethanone (CAS 1328939-64-5) is a chemical compound with the molecular formula C10H9F3OS and a molecular weight of 234.24 g/mol. IUPAC name: 1-[4-(2,2,2-trifluoroethylsulfanyl)phenyl]ethanone. InChIKey: UAFDTIBXBXGJFF-UHFFFAOYSA-N.
| Molecular formula | C10H9F3OS |
|---|---|
| Molecular weight | 234.24 g/mol |
| IUPAC name | 1-[4-(2,2,2-trifluoroethylsulfanyl)phenyl]ethanone |
| InChIKey | UAFDTIBXBXGJFF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)SCC(F)(F)F |
Computed by PubChem (NCBI)