Products 845823-09-8
CAS 845823-09-8 is the registry number for 4'-Ethylthio-2,2,2-trifluoroacetophenone, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
1-(4-ethylsulfanylphenyl)-2,2,2-trifluoroethanone (CAS 845823-09-8) is a chemical compound with the molecular formula C10H9F3OS and a molecular weight of 234.24 g/mol. IUPAC name: 1-(4-ethylsulfanylphenyl)-2,2,2-trifluoroethanone. InChIKey: PZELFQVSBHVSAQ-UHFFFAOYSA-N.
| Molecular formula | C10H9F3OS |
|---|---|
| Molecular weight | 234.24 g/mol |
| IUPAC name | 1-(4-ethylsulfanylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | PZELFQVSBHVSAQ-UHFFFAOYSA-N |
| SMILES | CCSC1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)