Products 1556140-05-6
CAS 1556140-05-6 is the registry number for 4-(Ethylthio)-3-(trifluoromethyl)benzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-ethylsulfanyl-3-(trifluoromethyl)benzaldehyde (CAS 1556140-05-6) is a chemical compound with the molecular formula C10H9F3OS and a molecular weight of 234.24 g/mol. IUPAC name: 4-ethylsulfanyl-3-(trifluoromethyl)benzaldehyde. InChIKey: WHTGFEWFGZRAQH-UHFFFAOYSA-N.
| Molecular formula | C10H9F3OS |
|---|---|
| Molecular weight | 234.24 g/mol |
| IUPAC name | 4-ethylsulfanyl-3-(trifluoromethyl)benzaldehyde |
| InChIKey | WHTGFEWFGZRAQH-UHFFFAOYSA-N |
| SMILES | CCSC1=C(C=C(C=C1)C=O)C(F)(F)F |
Computed by PubChem (NCBI)