Products 873463-88-8

CAS 873463-88-8 is the registry number for S-(4-(Trifluoromethyl)benzyl) ethanethioate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g.

Structural formula: {0} (CAS {1})

S-[[4-(trifluoromethyl)phenyl]methyl] ethanethioate (CAS 873463-88-8) is a chemical compound with the molecular formula C10H9F3OS and a molecular weight of 234.24 g/mol. IUPAC name: S-[[4-(trifluoromethyl)phenyl]methyl] ethanethioate. InChIKey: FZQGAAPWGZKBSM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9F3OS
Molecular weight234.24 g/mol
IUPAC nameS-[[4-(trifluoromethyl)phenyl]methyl] ethanethioate
InChIKeyFZQGAAPWGZKBSM-UHFFFAOYSA-N
SMILESCC(=O)SCC1=CC=C(C=C1)C(F)(F)F

Computed by PubChem (NCBI)