CAS 873463-88-8 is the registry number for S-(4-(Trifluoromethyl)benzyl) ethanethioate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g.
S-[[4-(trifluoromethyl)phenyl]methyl] ethanethioate (CAS 873463-88-8) is a chemical compound with the molecular formula C10H9F3OS and a molecular weight of 234.24 g/mol. IUPAC name: S-[[4-(trifluoromethyl)phenyl]methyl] ethanethioate. InChIKey: FZQGAAPWGZKBSM-UHFFFAOYSA-N.
| Molecular formula | C10H9F3OS |
|---|---|
| Molecular weight | 234.24 g/mol |
| IUPAC name | S-[[4-(trifluoromethyl)phenyl]methyl] ethanethioate |
| InChIKey | FZQGAAPWGZKBSM-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)