CAS 1329166-69-9 is the registry number for 2-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-5-nitroaniline, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-nitroaniline (CAS 1329166-69-9) is a chemical compound with the molecular formula C11H15BN2O4 and a molecular weight of 250.06 g/mol. IUPAC name: 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-nitroaniline. InChIKey: KHJFCYNSTNKMFO-UHFFFAOYSA-N.
| Molecular formula | C11H15BN2O4 |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-nitroaniline |
| InChIKey | KHJFCYNSTNKMFO-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)