CAS 2227082-58-6 is the registry number for 2-Nitro-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2227082-58-6) is a chemical compound with the molecular formula C11H15BN2O4 and a molecular weight of 250.06 g/mol. IUPAC name: 2-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: FTUDYNVKBCWBRQ-UHFFFAOYSA-N.
| Molecular formula | C11H15BN2O4 |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | 2-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | FTUDYNVKBCWBRQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)