Products 1841080-51-0
CAS 1841080-51-0 appears in our catalog under these names: 2-Nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95-<97%, 2-Nitro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. Offered by: Hoffman Fine Chemicals, Biosynth. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g, 50mg, 0,5g.
2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1841080-51-0) is a chemical compound with the molecular formula C11H15BN2O4 and a molecular weight of 250.06 g/mol. IUPAC name: 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: CCELCAOXPGETKP-UHFFFAOYSA-N.
| Molecular formula | C11H15BN2O4 |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | CCELCAOXPGETKP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)