CAS 1987879-03-7 appears in our catalog under these names: 3-Amino-5-(morpholinocarbonyl)phenylboronic acid, 96%, (3-Amino-5-(morpholine-4-carbonyl)phenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[3-amino-5-(morpholine-4-carbonyl)phenyl]boronic acid (CAS 1987879-03-7) is a chemical compound with the molecular formula C11H15BN2O4 and a molecular weight of 250.06 g/mol. IUPAC name: [3-amino-5-(morpholine-4-carbonyl)phenyl]boronic acid. InChIKey: CKXOOFBRAGWZHT-UHFFFAOYSA-N.
| Molecular formula | C11H15BN2O4 |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | [3-amino-5-(morpholine-4-carbonyl)phenyl]boronic acid |
| InChIKey | CKXOOFBRAGWZHT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C(=O)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)