Products 13294-87-6
CAS 13294-87-6 is the registry number for 9,​10-​Dihydro-​11-​methyl- 9,​10-​ethanoanthracene-​11-​carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid (CAS 13294-87-6) is a chemical compound with the molecular formula C18H16O2 and a molecular weight of 264.3 g/mol. IUPAC name: 15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid. InChIKey: NRUFZVGNVQBKSX-UHFFFAOYSA-N.
| Molecular formula | C18H16O2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid |
| InChIKey | NRUFZVGNVQBKSX-UHFFFAOYSA-N |
| SMILES | CC1(CC2C3=CC=CC=C3C1C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)