CAS 1329424-19-2 is the registry number for 8-Bromochroman-6-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-3,4-dihydro-2H-chromen-6-ol (CAS 1329424-19-2) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 8-bromo-3,4-dihydro-2H-chromen-6-ol. InChIKey: GJGVLIINLJBCQH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 8-bromo-3,4-dihydro-2H-chromen-6-ol |
| InChIKey | GJGVLIINLJBCQH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)O)Br)OC1 |
Computed by PubChem (NCBI)