Products 1329488-46-1
CAS 1329488-46-1 appears in our catalog under these names: O–desmethyl Mebeverine acid D5, Desmethyl Mebeverine Acid-d5, O-Desmethyl Mebeverine Acid-d5, O-Desmethyl Mebeverine acid-d5, 98.45%. Offered by: GLPBio, Chemat Brand, Hubei YoungXin, TRC, TargetMol. Available pack sizes: 1mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
4-[1-(4-hydroxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butanoic acid (CAS 1329488-46-1) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 270.38 g/mol. IUPAC name: 4-[1-(4-hydroxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butanoic acid. InChIKey: DJTCBAFIXOMULT-WNWXXORZSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 270.38 g/mol |
| IUPAC name | 4-[1-(4-hydroxyphenyl)propan-2-yl-(1,1,2,2,2-pentadeuterioethyl)amino]butanoic acid |
| InChIKey | DJTCBAFIXOMULT-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(CCCC(=O)O)C(C)CC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)