CAS 586357-02-0 appears in our catalog under these names: Desmethyl Mebeverine Acid, Mebeverine Acid Impurity 1 (Desmethyl Mebeverine Acid), O-Desmethyl Mebeverine Acid, >95% (HPLC), O–desmethyl Mebeverine acid, O-Desmethyl mebeverine acid. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
4-[ethyl-[1-(4-hydroxyphenyl)propan-2-yl]amino]butanoic acid (CAS 586357-02-0) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. IUPAC name: 4-[ethyl-[1-(4-hydroxyphenyl)propan-2-yl]amino]butanoic acid. InChIKey: DJTCBAFIXOMULT-UHFFFAOYSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | 4-[ethyl-[1-(4-hydroxyphenyl)propan-2-yl]amino]butanoic acid |
| InChIKey | DJTCBAFIXOMULT-UHFFFAOYSA-N |
| SMILES | CCN(CCCC(=O)O)C(C)CC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)