CAS 1329499-30-0 is the registry number for Synephrine-13C2,15N Hydrochloride Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 0,1mg, 1mg.
4-[1-hydroxy-2-(methyl(15N)amino)(1,2-13C2)ethyl](15N)phenol;hydrochloride (CAS 1329499-30-0) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 206.64 g/mol. IUPAC name: 4-[1-hydroxy-2-(methyl(15N)amino)(1,2-13C2)ethyl](15N)phenol;hydrochloride. InChIKey: COTCEGYSNTWJQV-GMPMXYEBSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 206.64 g/mol |
| IUPAC name | 4-[1-hydroxy-2-(methyl(15N)amino)(1,2-13C2)ethyl](15N)phenol;hydrochloride |
| InChIKey | COTCEGYSNTWJQV-GMPMXYEBSA-N |
| SMILES | C[15NH][13CH2][13CH](C1=CC=C(C=C1)O)O.Cl |
Computed by PubChem (NCBI)