CAS 24940-67-8 is the registry number for R-(-)-p-Synephrine Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
4-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 24940-67-8) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: COTCEGYSNTWJQV-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| InChIKey | COTCEGYSNTWJQV-FVGYRXGTSA-N |
| SMILES | CNC[C@@H](C1=CC=C(C=C1)O)O.Cl |
Computed by PubChem (NCBI)