CAS 13295-53-9 appears in our catalog under these names: Cyclobutylmethyl 4-methylbenzenesulfonate, 95%, Cyclobutylmethyl 4-methylbenzenesulfonate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Cyclobutylmethyl 4-methylbenzenesulfonate (CAS 13295-53-9) is a chemical compound with the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. IUPAC name: cyclobutylmethyl 4-methylbenzenesulfonate. InChIKey: RNIHFEJHABJCID-UHFFFAOYSA-N.
| Molecular formula | C12H16O3S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | cyclobutylmethyl 4-methylbenzenesulfonate |
| InChIKey | RNIHFEJHABJCID-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2CCC2 |
Computed by PubChem (NCBI)