CAS 63064-31-3 appears in our catalog under these names: Toluene-4-sulfonic acid 2-cyclopropyl-ethyl ester, 95%, 2-Cyclopropylethyl 4-methylbenzenesulfonate, 97%, 2–Cyclopropylethyl 4–methylbenzenesulfonate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-cyclopropylethyl 4-methylbenzenesulfonate (CAS 63064-31-3) is a chemical compound with the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. IUPAC name: 2-cyclopropylethyl 4-methylbenzenesulfonate. InChIKey: JVOCWIRGDNWGKH-UHFFFAOYSA-N.
| Molecular formula | C12H16O3S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 2-cyclopropylethyl 4-methylbenzenesulfonate |
| InChIKey | JVOCWIRGDNWGKH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2CC2 |
Computed by PubChem (NCBI)