CAS 1344952-38-0 appears in our catalog under these names: Ethyl 2-({4-((1R)-1-hydroxyethyl)phenyl}sulfanyl)acetate, 95%, Ethyl 2-({4-((1R)-1-hydroxyethyl)phenyl}sulfanyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 2-[4-[(1R)-1-hydroxyethyl]phenyl]sulfanylacetate (CAS 1344952-38-0) is a chemical compound with the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. IUPAC name: ethyl 2-[4-[(1R)-1-hydroxyethyl]phenyl]sulfanylacetate. InChIKey: ZAYMVLHANSCUMM-SECBINFHSA-N.
| Molecular formula | C12H16O3S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | ethyl 2-[4-[(1R)-1-hydroxyethyl]phenyl]sulfanylacetate |
| InChIKey | ZAYMVLHANSCUMM-SECBINFHSA-N |
| SMILES | CCOC(=O)CSC1=CC=C(C=C1)[C@@H](C)O |
Computed by PubChem (NCBI)